C23H24Cl2N4O2 — CID 162491634
N-[2-[(E)-2-cyano-4-methylpent-2-enoyl]-1-[2-(3,4-dichlorophenyl)ethynyl]cyclopropyl]piperazine-1-carboxamide (PubChem CID 162491634) has the molecular formula C23H24Cl2N4O2 and a molecular weight of 459.38 g/mol. Its IUPAC name is N-[2-[(E)-2-cyano-4-methylpent-2-enoyl]-1-[2-(3,4-dichlorophenyl)ethynyl]cyclopropyl]piperazine-1-carboxamide.
| Compound Name | N-[2-[(E)-2-cyano-4-methylpent-2-enoyl]-1-[2-(3,4-dichlorophenyl)ethynyl]cyclopropyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 162491634 |
| Molecular Formula | C23H24Cl2N4O2 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[2-[(E)-2-cyano-4-methylpent-2-enoyl]-1-[2-(3,4-dichlorophenyl)ethynyl]cyclopropyl]piperazine-1-carboxamide |
| SMILES | CC(C)/C=C(\C#N)C(=O)C1CC1(C#Cc1ccc(Cl)c(Cl)c1)NC(=O)N1CCNCC1 |
| InChI | InChI=1S/C23H24Cl2N4O2/c1-15(2)11-17(14-26)21(30)18-13-23(18,28-22(31)29-9-7-27-8-10-29)6-5-16-3-4-19(24)20(25)12-16/h3-4,11-12,15,18,27H,7-10,13H2,1-2H3,(H,28,31)/b17-11+ |
| InChIKey | HQVFGNKELPEKEY-GZTJUZNOSA-N |
| XLogP | 3.39 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|