C20H25Cl2N3O2 — CID 139335606
N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-(2,2-dimethylpropanoyl)piperazine-1-carboxamide (PubChem CID 139335606) has the molecular formula C20H25Cl2N3O2 and a molecular weight of 410.35 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-(2,2-dimethylpropanoyl)piperazine-1-carboxamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-(2,2-dimethylpropanoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 139335606 |
| Molecular Formula | C20H25Cl2N3O2 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-(2,2-dimethylpropanoyl)piperazine-1-carboxamide |
| SMILES | CC(C#Cc1ccc(Cl)c(Cl)c1)NC(=O)N1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H25Cl2N3O2/c1-14(5-6-15-7-8-16(21)17(22)13-15)23-19(27)25-11-9-24(10-12-25)18(26)20(2,3)4/h7-8,13-14H,9-12H2,1-4H3,(H,23,27) |
| InChIKey | GGQAFMHCFJCBOK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|