C18H19ClFN3O2 — CID 139335523
N-[4-(3-chloro-4-fluorophenyl)but-3-yn-2-yl]-4-prop-2-enoylpiperazine-1-carboxamide (PubChem CID 139335523) has the molecular formula C18H19ClFN3O2 and a molecular weight of 363.82 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluorophenyl)but-3-yn-2-yl]-4-prop-2-enoylpiperazine-1-carboxamide.
| Compound Name | N-[4-(3-chloro-4-fluorophenyl)but-3-yn-2-yl]-4-prop-2-enoylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 139335523 |
| Molecular Formula | C18H19ClFN3O2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[4-(3-chloro-4-fluorophenyl)but-3-yn-2-yl]-4-prop-2-enoylpiperazine-1-carboxamide |
| SMILES | C=CC(=O)N1CCN(C(=O)NC(C)C#Cc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H19ClFN3O2/c1-3-17(24)22-8-10-23(11-9-22)18(25)21-13(2)4-5-14-6-7-16(20)15(19)12-14/h3,6-7,12-13H,1,8-11H2,2H3,(H,21,25) |
| InChIKey | CRPJDHJOEXWLFY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|