C19H20Cl2N4O3 — CID 139335512
4-[(E)-4-amino-4-oxobut-2-enoyl]-N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]piperazine-1-carboxamide (PubChem CID 139335512) has the molecular formula C19H20Cl2N4O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is 4-[(E)-4-amino-4-oxobut-2-enoyl]-N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-[(E)-4-amino-4-oxobut-2-enoyl]-N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 139335512 |
| Molecular Formula | C19H20Cl2N4O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 4-[(E)-4-amino-4-oxobut-2-enoyl]-N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]piperazine-1-carboxamide |
| SMILES | CC(C#Cc1ccc(Cl)c(Cl)c1)NC(=O)N1CCN(C(=O)/C=C/C(N)=O)CC1 |
| InChI | InChI=1S/C19H20Cl2N4O3/c1-13(2-3-14-4-5-15(20)16(21)12-14)23-19(28)25-10-8-24(9-11-25)18(27)7-6-17(22)26/h4-7,12-13H,8-11H2,1H3,(H2,22,26)(H,23,28)/b7-6+ |
| InChIKey | VUSBHZBYICCIFB-VOTSOKGWSA-N |
| XLogP | 1.63 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|