C19H19Cl2N5O — CID 139330127
N-cyano-N'-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-prop-2-enoylpiperazine-1-carboximidamide (PubChem CID 139330127) has the molecular formula C19H19Cl2N5O and a molecular weight of 404.30 g/mol. Its IUPAC name is N-cyano-N'-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-prop-2-enoylpiperazine-1-carboximidamide.
| Compound Name | N-cyano-N'-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-prop-2-enoylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 139330127 |
| Molecular Formula | C19H19Cl2N5O |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-cyano-N'-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-prop-2-enoylpiperazine-1-carboximidamide |
| SMILES | C=CC(=O)N1CCN(/C(=N/C(C)C#Cc2ccc(Cl)c(Cl)c2)NC#N)CC1 |
| InChI | InChI=1S/C19H19Cl2N5O/c1-3-18(27)25-8-10-26(11-9-25)19(23-13-22)24-14(2)4-5-15-6-7-16(20)17(21)12-15/h3,6-7,12,14H,1,8-11H2,2H3,(H,23,24) |
| InChIKey | DOYHMASXCGPTQO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|