C19H21Cl2N3O2 — CID 139335526
N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-(prop-2-enoylamino)piperidine-1-carboxamide (PubChem CID 139335526) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-(prop-2-enoylamino)piperidine-1-carboxamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-(prop-2-enoylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 139335526 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)but-3-yn-2-yl]-4-(prop-2-enoylamino)piperidine-1-carboxamide |
| SMILES | C=CC(=O)NC1CCN(C(=O)NC(C)C#Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-3-18(25)23-15-8-10-24(11-9-15)19(26)22-13(2)4-5-14-6-7-16(20)17(21)12-14/h3,6-7,12-13,15H,1,8-11H2,2H3,(H,22,26)(H,23,25) |
| InChIKey | JSWYAGVXQNRFOK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|