C20H22Cl2FNO2S — CID 162522663
2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]sulfanyl-N-ethylacetamide (PubChem CID 162522663) has the molecular formula C20H22Cl2FNO2S and a molecular weight of 430.37 g/mol. Its IUPAC name is 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]sulfanyl-N-ethylacetamide.
| Compound Name | 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]sulfanyl-N-ethylacetamide |
|---|---|
| PubChem CID | 162522663 |
| Molecular Formula | C20H22Cl2FNO2S |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-[3,5-dichloro-2-fluoro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]sulfanyl-N-ethylacetamide |
| SMILES | CCNC(=O)CSc1cc(Cl)c(Cc2ccc(O)c(C(C)C)c2)c(Cl)c1F |
| InChI | InChI=1S/C20H22Cl2FNO2S/c1-4-24-18(26)10-27-17-9-15(21)14(19(22)20(17)23)8-12-5-6-16(25)13(7-12)11(2)3/h5-7,9,11,25H,4,8,10H2,1-3H3,(H,24,26) |
| InChIKey | VUVTWACMJFXTHV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|