C15H8F13I — CID 162538579
1-iodo-4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-1-enyl)benzene (PubChem CID 162538579) has the molecular formula C15H8F13I and a molecular weight of 562.11 g/mol. Its IUPAC name is 1-iodo-4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-1-enyl)benzene.
| Compound Name | 1-iodo-4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-1-enyl)benzene |
|---|---|
| PubChem CID | 162538579 |
| Molecular Formula | C15H8F13I |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.95 |
| IUPAC Name | 1-iodo-4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-1-enyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC=Cc1ccc(I)cc1 |
| InChI | InChI=1S/C15H8F13I/c16-10(17,7-1-2-8-3-5-9(29)6-4-8)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h1-6H,7H2 |
| InChIKey | VSKVPDZKTJYWGB-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|