C17H11F6IO — CID 166059804
(E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-(4-iodophenyl)pent-1-en-3-ol (PubChem CID 166059804) has the molecular formula C17H11F6IO and a molecular weight of 472.17 g/mol. Its IUPAC name is (E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-(4-iodophenyl)pent-1-en-3-ol.
| Compound Name | (E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-(4-iodophenyl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 166059804 |
| Molecular Formula | C17H11F6IO |
| Molecular Weight | 472.17 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | (E)-4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)-3-(4-iodophenyl)pent-1-en-3-ol |
| SMILES | OC(/C=C/c1ccc(F)cc1)(c1ccc(I)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H11F6IO/c18-13-5-1-11(2-6-13)9-10-15(25,16(19,20)17(21,22)23)12-3-7-14(24)8-4-12/h1-10,25H/b10-9+ |
| InChIKey | PBMQCXCFOGFYNQ-MDZDMXLPSA-N |
| XLogP | 5.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.17 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|