C11H8Cl2F6N3S+ — CID 162546554
3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methyl-5-(trifluoromethyl)-2H-thiadiazol-1-ium-4-amine (PubChem CID 162546554) has the molecular formula C11H8Cl2F6N3S+ and a molecular weight of 399.17 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methyl-5-(trifluoromethyl)-2H-thiadiazol-1-ium-4-amine.
| Compound Name | 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methyl-5-(trifluoromethyl)-2H-thiadiazol-1-ium-4-amine |
|---|---|
| PubChem CID | 162546554 |
| Molecular Formula | C11H8Cl2F6N3S+ |
| Molecular Weight | 399.17 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methyl-5-(trifluoromethyl)-2H-thiadiazol-1-ium-4-amine |
| SMILES | C[S+]1NN(c2c(Cl)cc(C(F)(F)F)cc2Cl)C(N)=C1C(F)(F)F |
| InChI | InChI=1S/C11H8Cl2F6N3S/c1-23-8(11(17,18)19)9(20)22(21-23)7-5(12)2-4(3-6(7)13)10(14,15)16/h2-3,21H,20H2,1H3/q+1 |
| InChIKey | OLAVRGYESTWEHX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.17 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|