C25H28F6N6O2 — CID 162551964
tert-butyl (5S)-5-[(N-iminocarbamimidoyl)-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]-7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate (PubChem CID 162551964) has the molecular formula C25H28F6N6O2 and a molecular weight of 558.53 g/mol. Its IUPAC name is tert-butyl (5S)-5-[(N-iminocarbamimidoyl)-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]-7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-[(N-iminocarbamimidoyl)-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]-7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 162551964 |
| Molecular Formula | C25H28F6N6O2 |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | tert-butyl (5S)-5-[(N-iminocarbamimidoyl)-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]-7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carboxylate |
| SMILES | [H]/N=C(\N=N\[H])N(Cc1ccc(C(F)(F)F)nc1)[C@H]1CCCN(C(=O)OC(C)(C)C)c2cc(C(F)(F)F)c(C)cc21 |
| InChI | InChI=1S/C25H28F6N6O2/c1-14-10-16-18(37(21(32)35-33)13-15-7-8-20(34-12-15)25(29,30)31)6-5-9-36(22(38)39-23(2,3)4)19(16)11-17(14)24(26,27)28/h7-8,10-12,18,32-33H,5-6,9,13H2,1-4H3/b32-21+,35-33+/t18-/m0/s1 |
| InChIKey | UWULBBCEVFZTNQ-FOVCRUHISA-N |
| XLogP | 7.47 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|