C15H10ClF3N2O — CID 162553856
1-(2-chlorophenyl)-5-[(Z)-1-methoxybut-1-en-3-ynyl]-3-(trifluoromethyl)pyrazole (PubChem CID 162553856) has the molecular formula C15H10ClF3N2O and a molecular weight of 326.71 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-[(Z)-1-methoxybut-1-en-3-ynyl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-(2-chlorophenyl)-5-[(Z)-1-methoxybut-1-en-3-ynyl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 162553856 |
| Molecular Formula | C15H10ClF3N2O |
| Molecular Weight | 326.71 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1-(2-chlorophenyl)-5-[(Z)-1-methoxybut-1-en-3-ynyl]-3-(trifluoromethyl)pyrazole |
| SMILES | C#C/C=C(\OC)c1cc(C(F)(F)F)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C15H10ClF3N2O/c1-3-6-13(22-2)12-9-14(15(17,18)19)20-21(12)11-8-5-4-7-10(11)16/h1,4-9H,2H3/b13-6- |
| InChIKey | MVRSWVFTBWCYKG-MLPAPPSSSA-N |
| XLogP | 4.16 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|