C20H25F3N6O5S — CID 162577307
N-[2-[(N'-methylcarbamimidoyl)amino]oxyethyl]-2-[6-methyl-2-oxo-3-[[3-(trifluoromethyl)phenyl]methylsulfonylamino]-1-pyridinyl]acetamide (PubChem CID 162577307) has the molecular formula C20H25F3N6O5S and a molecular weight of 518.52 g/mol. Its IUPAC name is N-[2-[(N'-methylcarbamimidoyl)amino]oxyethyl]-2-[6-methyl-2-oxo-3-[[3-(trifluoromethyl)phenyl]methylsulfonylamino]-1-pyridinyl]acetamide.
| Compound Name | N-[2-[(N'-methylcarbamimidoyl)amino]oxyethyl]-2-[6-methyl-2-oxo-3-[[3-(trifluoromethyl)phenyl]methylsulfonylamino]-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 162577307 |
| Molecular Formula | C20H25F3N6O5S |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | N-[2-[(N'-methylcarbamimidoyl)amino]oxyethyl]-2-[6-methyl-2-oxo-3-[[3-(trifluoromethyl)phenyl]methylsulfonylamino]-1-pyridinyl]acetamide |
| SMILES | C/N=C(\N)NOCCNC(=O)Cn1c(C)ccc(NS(=O)(=O)Cc2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C20H25F3N6O5S/c1-13-6-7-16(18(31)29(13)11-17(30)26-8-9-34-27-19(24)25-2)28-35(32,33)12-14-4-3-5-15(10-14)20(21,22)23/h3-7,10,28H,8-9,11-12H2,1-2H3,(H,26,30)(H3,24,25,27) |
| InChIKey | FZOVFTMUPYWYEU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|