C24H31F3O4S2 — CID 162579349
[4-[2-[5-(4,4-dimethyl-3-oxopentyl)-4-methylthiophen-2-yl]butan-2-yl]-2-methylphenyl] trifluoromethanesulfonate (PubChem CID 162579349) has the molecular formula C24H31F3O4S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is [4-[2-[5-(4,4-dimethyl-3-oxopentyl)-4-methylthiophen-2-yl]butan-2-yl]-2-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[2-[5-(4,4-dimethyl-3-oxopentyl)-4-methylthiophen-2-yl]butan-2-yl]-2-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162579349 |
| Molecular Formula | C24H31F3O4S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | [4-[2-[5-(4,4-dimethyl-3-oxopentyl)-4-methylthiophen-2-yl]butan-2-yl]-2-methylphenyl] trifluoromethanesulfonate |
| SMILES | CCC(C)(c1ccc(OS(=O)(=O)C(F)(F)F)c(C)c1)c1cc(C)c(CCC(=O)C(C)(C)C)s1 |
| InChI | InChI=1S/C24H31F3O4S2/c1-8-23(7,21-14-16(3)19(32-21)11-12-20(28)22(4,5)6)17-9-10-18(15(2)13-17)31-33(29,30)24(25,26)27/h9-10,13-14H,8,11-12H2,1-7H3 |
| InChIKey | SUCUGUFBERTJFI-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|