C32H34F3NO2 — CID 162586476
(2R)-4-methyl-2-[3-[2-(2-phenylethyl)piperidin-1-yl]-5-[4-(trifluoromethyl)phenyl]phenyl]pent-3-enoic acid (PubChem CID 162586476) has the molecular formula C32H34F3NO2 and a molecular weight of 521.62 g/mol. Its IUPAC name is (2R)-4-methyl-2-[3-[2-(2-phenylethyl)piperidin-1-yl]-5-[4-(trifluoromethyl)phenyl]phenyl]pent-3-enoic acid.
| Compound Name | (2R)-4-methyl-2-[3-[2-(2-phenylethyl)piperidin-1-yl]-5-[4-(trifluoromethyl)phenyl]phenyl]pent-3-enoic acid |
|---|---|
| PubChem CID | 162586476 |
| Molecular Formula | C32H34F3NO2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | (2R)-4-methyl-2-[3-[2-(2-phenylethyl)piperidin-1-yl]-5-[4-(trifluoromethyl)phenyl]phenyl]pent-3-enoic acid |
| SMILES | CC(C)=C[C@@H](C(=O)O)c1cc(-c2ccc(C(F)(F)F)cc2)cc(N2CCCCC2CCc2ccccc2)c1 |
| InChI | InChI=1S/C32H34F3NO2/c1-22(2)18-30(31(37)38)26-19-25(24-12-14-27(15-13-24)32(33,34)35)20-29(21-26)36-17-7-6-10-28(36)16-11-23-8-4-3-5-9-23/h3-5,8-9,12-15,18-21,28,30H,6-7,10-11,16-17H2,1-2H3,(H,37,38)/t28?,30-/m1/s1 |
| InChIKey | JMKNZMBCHNVGFQ-FUJFQHJFSA-N |
| XLogP | 8.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|