C33H34F3N3O5S — CID 162606916
N-(3,3-dihydroxypropyl)-4-[(2S,3R)-1-[4-(2-methyl-1,3-thiazol-5-yl)anilino]-1-oxo-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzamide (PubChem CID 162606916) has the molecular formula C33H34F3N3O5S and a molecular weight of 641.71 g/mol. Its IUPAC name is N-(3,3-dihydroxypropyl)-4-[(2S,3R)-1-[4-(2-methyl-1,3-thiazol-5-yl)anilino]-1-oxo-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzamide.
| Compound Name | N-(3,3-dihydroxypropyl)-4-[(2S,3R)-1-[4-(2-methyl-1,3-thiazol-5-yl)anilino]-1-oxo-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzamide |
|---|---|
| PubChem CID | 162606916 |
| Molecular Formula | C33H34F3N3O5S |
| Molecular Weight | 641.71 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | N-(3,3-dihydroxypropyl)-4-[(2S,3R)-1-[4-(2-methyl-1,3-thiazol-5-yl)anilino]-1-oxo-2-[4-(trifluoromethoxy)phenyl]hexan-3-yl]benzamide |
| SMILES | CCC[C@@H](c1ccc(C(=O)NCCC(O)O)cc1)[C@H](C(=O)Nc1ccc(-c2cnc(C)s2)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C33H34F3N3O5S/c1-3-4-27(21-5-7-24(8-6-21)31(42)37-18-17-29(40)41)30(23-11-15-26(16-12-23)44-33(34,35)36)32(43)39-25-13-9-22(10-14-25)28-19-38-20(2)45-28/h5-16,19,27,29-30,40-41H,3-4,17-18H2,1-2H3,(H,37,42)(H,39,43)/t27-,30+/m0/s1 |
| InChIKey | VMZNGSBBHCOYBK-BHBYDHKZSA-N |
| XLogP | 6.75 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.71 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|