C32H35ClF3N3O3 — CID 162619292
2-[3-[(E)-3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]prop-1-enoxy]piperidin-1-yl]-N-hydroxyacetamide (PubChem CID 162619292) has the molecular formula C32H35ClF3N3O3 and a molecular weight of 602.10 g/mol. Its IUPAC name is 2-[3-[(E)-3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]prop-1-enoxy]piperidin-1-yl]-N-hydroxyacetamide.
| Compound Name | 2-[3-[(E)-3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]prop-1-enoxy]piperidin-1-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 162619292 |
| Molecular Formula | C32H35ClF3N3O3 |
| Molecular Weight | 602.10 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 2-[3-[(E)-3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]prop-1-enoxy]piperidin-1-yl]-N-hydroxyacetamide |
| SMILES | O=C(CN1CCCC(O/C=C/CN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)C1)NO |
| InChI | InChI=1S/C32H35ClF3N3O3/c33-31-26(14-7-16-29(31)32(34,35)36)20-38(18-9-19-42-27-15-8-17-39(21-27)23-30(40)37-41)22-28(24-10-3-1-4-11-24)25-12-5-2-6-13-25/h1-7,9-14,16,19,27-28,41H,8,15,17-18,20-23H2,(H,37,40)/b19-9+ |
| InChIKey | ZYJBRNHOWDYSQN-DJKKODMXSA-N |
| XLogP | 6.49 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.10 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|