C11H10F6N2O4 — CID 162621745
[1-(3,4-dicarboxyanilino)-1,2,2,3,3,3-hexafluoropropyl]azanium;hydride (PubChem CID 162621745) has the molecular formula C11H10F6N2O4 and a molecular weight of 348.20 g/mol. Its IUPAC name is [1-(3,4-dicarboxyanilino)-1,2,2,3,3,3-hexafluoropropyl]azanium;hydride.
| Compound Name | [1-(3,4-dicarboxyanilino)-1,2,2,3,3,3-hexafluoropropyl]azanium;hydride |
|---|---|
| PubChem CID | 162621745 |
| Molecular Formula | C11H10F6N2O4 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [1-(3,4-dicarboxyanilino)-1,2,2,3,3,3-hexafluoropropyl]azanium;hydride |
| SMILES | [H-].[NH3+]C(F)(Nc1ccc(C(=O)O)c(C(=O)O)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F6N2O4.H/c12-9(13,10(14,15)16)11(17,18)19-4-1-2-5(7(20)21)6(3-4)8(22)23;/h1-3,19H,18H2,(H,20,21)(H,22,23);/q;-1/p+1 |
| InChIKey | SZYXKHWWFODEGL-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|