About ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate
ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate (PubChem CID 162626592) has the molecular formula C18H24N2O3
and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate |
| PubChem CID | 162626592 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CC3(COc4ccccc4C3)C2)C1 |
| InChI | InChI=1S/C18H24N2O3/c1-2-22-17(21)19-8-7-15(10-19)20-11-18(12-20)9-14-5-3-4-6-16(14)23-13-18/h3-6,15H,2,7-13H2,1H3 |
| InChIKey | KEDHHOSFFUGNGS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate?
The IUPAC name of ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate (CID 162626592) is ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate.
What is the SMILES notation for ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate?
The canonical SMILES for ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate is CCOC(=O)N1CCC(N2CC3(COc4ccccc4C3)C2)C1.
What is the InChIKey of ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate?
The InChIKey is KEDHHOSFFUGNGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O3/c1-2-22-17(21)19-8-7-15(10-19)20-11-18(12-20)9-14-5-3-4-6-16(14)23-13-18/h3-6,15H,2,7-13H2,1H3.
What are the key properties of ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate?
ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate has a molecular weight of 316.40 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylpyrrolidine-1-carboxylate is sourced from PubChem (CID 162626592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).