C16H21N3O4S — CID 162630443
6-(4-cyclopropyl-2-methylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 162630443) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 6-(4-cyclopropyl-2-methylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-cyclopropyl-2-methylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 162630443 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-(4-cyclopropyl-2-methylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1CN(C2CC2)CCN1S(=O)(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C16H21N3O4S/c1-11-9-18(12-2-3-12)6-7-19(11)24(21,22)13-4-5-15-14(8-13)17-16(20)10-23-15/h4-5,8,11-12H,2-3,6-7,9-10H2,1H3,(H,17,20) |
| InChIKey | BCGYQFGQKKSJCV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |