C20H28N6O3 — CID 162634607
(1S,3R,4R)-3-methoxy-4-(phenylcarbamoylamino)-N-[3-(triazol-1-yl)propyl]cyclohexane-1-carboxamide (PubChem CID 162634607) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is (1S,3R,4R)-3-methoxy-4-(phenylcarbamoylamino)-N-[3-(triazol-1-yl)propyl]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R)-3-methoxy-4-(phenylcarbamoylamino)-N-[3-(triazol-1-yl)propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 162634607 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (1S,3R,4R)-3-methoxy-4-(phenylcarbamoylamino)-N-[3-(triazol-1-yl)propyl]cyclohexane-1-carboxamide |
| SMILES | CO[C@@H]1C[C@@H](C(=O)NCCCn2ccnn2)CC[C@H]1NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H28N6O3/c1-29-18-14-15(19(27)21-10-5-12-26-13-11-22-25-26)8-9-17(18)24-20(28)23-16-6-3-2-4-7-16/h2-4,6-7,11,13,15,17-18H,5,8-10,12,14H2,1H3,(H,21,27)(H2,23,24,28)/t15-,17+,18+/m0/s1 |
| InChIKey | IIKOQIISYFAAGF-CGTJXYLNSA-N |
| XLogP | 1.79 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|