C12H14N6 — CID 162642408
2,2,3,3,5,5,6,6-octadeuterio-1,4-di(pyrimidin-2-yl)piperazine (PubChem CID 162642408) has the molecular formula C12H14N6 and a molecular weight of 250.33 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octadeuterio-1,4-di(pyrimidin-2-yl)piperazine.
| Compound Name | 2,2,3,3,5,5,6,6-octadeuterio-1,4-di(pyrimidin-2-yl)piperazine |
|---|---|
| PubChem CID | 162642408 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octadeuterio-1,4-di(pyrimidin-2-yl)piperazine |
| SMILES | [2H]C1([2H])N(c2ncccn2)C([2H])([2H])C([2H])([2H])N(c2ncccn2)C1([2H])[2H] |
| InChI | InChI=1S/C12H14N6/c1-3-13-11(14-4-1)17-7-9-18(10-8-17)12-15-5-2-6-16-12/h1-6H,7-10H2/i7D2,8D2,9D2,10D2 |
| InChIKey | CGDIIYVMINKXRL-UFBJYANTSA-N |
| XLogP | 0.59 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |