C28H21N5O — CID 162645464
1-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]-2,3-dihydroindol-1-yl]prop-2-en-1-one (PubChem CID 162645464) has the molecular formula C28H21N5O and a molecular weight of 443.51 g/mol. Its IUPAC name is 1-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]-2,3-dihydroindol-1-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162645464 |
| Molecular Formula | C28H21N5O |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-[6-[(6-quinolin-3-ylquinazolin-4-yl)amino]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ccc(Nc3ncnc4ccc(-c5cnc6ccccc6c5)cc34)cc21 |
| InChI | InChI=1S/C28H21N5O/c1-2-27(34)33-12-11-18-7-9-22(15-26(18)33)32-28-23-14-19(8-10-25(23)30-17-31-28)21-13-20-5-3-4-6-24(20)29-16-21/h2-10,13-17H,1,11-12H2,(H,30,31,32) |
| InChIKey | PDZUKHZERVLKNO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|