C12H19N3O10 — CID 162650940
2-[2-[bis(carboxymethyl)amino]ethyl-[2-(dicarboxyamino)ethyl]amino]acetic acid (PubChem CID 162650940) has the molecular formula C12H19N3O10 and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-(dicarboxyamino)ethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-(dicarboxyamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 162650940 |
| Molecular Formula | C12H19N3O10 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-(dicarboxyamino)ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H19N3O10/c16-8(17)5-13(3-4-15(11(22)23)12(24)25)1-2-14(6-9(18)19)7-10(20)21/h1-7H2,(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | XZUQIOUHUXYLCJ-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 196.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |