C18H15N3O4S — CID 162653532
5-[(4-formyl-3-hydroxynaphthalen-2-yl)diazenyl]-2-methylbenzenesulfonamide (PubChem CID 162653532) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is 5-[(4-formyl-3-hydroxynaphthalen-2-yl)diazenyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-[(4-formyl-3-hydroxynaphthalen-2-yl)diazenyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 162653532 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 5-[(4-formyl-3-hydroxynaphthalen-2-yl)diazenyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(/N=N/c2cc3ccccc3c(C=O)c2O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C18H15N3O4S/c1-11-6-7-13(9-17(11)26(19,24)25)20-21-16-8-12-4-2-3-5-14(12)15(10-22)18(16)23/h2-10,23H,1H3,(H2,19,24,25)/b21-20+ |
| InChIKey | KDDFJLNFZVDNAA-QZQOTICOSA-N |
| XLogP | 3.73 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|