C16H20N6 — CID 162657986
2-N-[3-(dimethylamino)propyl]pyrido[3,4-g]quinazoline-2,10-diamine (PubChem CID 162657986) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]pyrido[3,4-g]quinazoline-2,10-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]pyrido[3,4-g]quinazoline-2,10-diamine |
|---|---|
| PubChem CID | 162657986 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]pyrido[3,4-g]quinazoline-2,10-diamine |
| SMILES | CN(C)CCCNc1ncc2cc3cnccc3c(N)c2n1 |
| InChI | InChI=1S/C16H20N6/c1-22(2)7-3-5-19-16-20-10-12-8-11-9-18-6-4-13(11)14(17)15(12)21-16/h4,6,8-10H,3,5,7,17H2,1-2H3,(H,19,20,21) |
| InChIKey | DMOJZRQEFRSMBQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|