C17H21N5 — CID 59198292
N-[5-[2-(3-aminophenyl)ethynyl]pyrimidin-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 59198292) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is N-[5-[2-(3-aminophenyl)ethynyl]pyrimidin-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[5-[2-(3-aminophenyl)ethynyl]pyrimidin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 59198292 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-[5-[2-(3-aminophenyl)ethynyl]pyrimidin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1ncc(C#Cc2cccc(N)c2)cn1 |
| InChI | InChI=1S/C17H21N5/c1-22(2)10-4-9-19-17-20-12-15(13-21-17)8-7-14-5-3-6-16(18)11-14/h3,5-6,11-13H,4,9-10,18H2,1-2H3,(H,19,20,21) |
| InChIKey | IQDKKGYEBPJYMY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|