C7H11FN2OS — CID 162690541
(2S,5R)-2-(fluoromethyl)-6-sulfanyl-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 162690541) has the molecular formula C7H11FN2OS and a molecular weight of 190.24 g/mol. Its IUPAC name is (2S,5R)-2-(fluoromethyl)-6-sulfanyl-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S,5R)-2-(fluoromethyl)-6-sulfanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 162690541 |
| Molecular Formula | C7H11FN2OS |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2S,5R)-2-(fluoromethyl)-6-sulfanyl-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N(S)[C@@H]2CC[C@@H](CF)N1C2 |
| InChI | InChI=1S/C7H11FN2OS/c8-3-5-1-2-6-4-9(5)7(11)10(6)12/h5-6,12H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | PTDGFRLJAWCDSR-NTSWFWBYSA-N |
| XLogP | 1.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|