C21H19FN6O — CID 162690801
N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-1-(6-methyl-2-pyridinyl)indazole-5-carboxamide (PubChem CID 162690801) has the molecular formula C21H19FN6O and a molecular weight of 390.42 g/mol. Its IUPAC name is N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-1-(6-methyl-2-pyridinyl)indazole-5-carboxamide.
| Compound Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-1-(6-methyl-2-pyridinyl)indazole-5-carboxamide |
|---|---|
| PubChem CID | 162690801 |
| Molecular Formula | C21H19FN6O |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-1-(6-methyl-2-pyridinyl)indazole-5-carboxamide |
| SMILES | Cc1cccc(-n2ncc3cc(C(=O)N[C@@H]4C[C@@H]5CC[C@H]4N5C#N)c(F)cc32)n1 |
| InChI | InChI=1S/C21H19FN6O/c1-12-3-2-4-20(25-12)28-19-9-16(22)15(7-13(19)10-24-28)21(29)26-17-8-14-5-6-18(17)27(14)11-23/h2-4,7,9-10,14,17-18H,5-6,8H2,1H3,(H,26,29)/t14-,17+,18+/m0/s1 |
| InChIKey | HJVKVOQHCUYLPH-BMGDILEWSA-N |
| XLogP | 2.68 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|