C24H25N7O — CID 167339622
N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-[6-(1-cyanocyclopropyl)-2-pyridinyl]-4,5,6,7-tetrahydroindazole-5-carboxamide (PubChem CID 167339622) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-[6-(1-cyanocyclopropyl)-2-pyridinyl]-4,5,6,7-tetrahydroindazole-5-carboxamide.
| Compound Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-[6-(1-cyanocyclopropyl)-2-pyridinyl]-4,5,6,7-tetrahydroindazole-5-carboxamide |
|---|---|
| PubChem CID | 167339622 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-[6-(1-cyanocyclopropyl)-2-pyridinyl]-4,5,6,7-tetrahydroindazole-5-carboxamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)C1CCc3nn(-c4cccc(C5(C#N)CC5)n4)cc3C1)C2 |
| InChI | InChI=1S/C24H25N7O/c25-13-24(8-9-24)21-2-1-3-22(28-21)31-12-16-10-15(4-6-18(16)29-31)23(32)27-19-11-17-5-7-20(19)30(17)14-26/h1-3,12,15,17,19-20H,4-11H2,(H,27,32)/t15?,17-,19+,20+/m0/s1 |
| InChIKey | IEQQFSVNZHPGBK-RWWRMHFQSA-N |
| XLogP | 2.13 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|