C6H12ClNO — CID 162705405
4-(2-chloroethyl)-2,2,3,3-tetradeuteriomorpholine (PubChem CID 162705405) has the molecular formula C6H12ClNO and a molecular weight of 153.65 g/mol. Its IUPAC name is 4-(2-chloroethyl)-2,2,3,3-tetradeuteriomorpholine.
| Compound Name | 4-(2-chloroethyl)-2,2,3,3-tetradeuteriomorpholine |
|---|---|
| PubChem CID | 162705405 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 153.65 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 4-(2-chloroethyl)-2,2,3,3-tetradeuteriomorpholine |
| SMILES | [2H]C1([2H])OCCN(CCCl)C1([2H])[2H] |
| InChI | InChI=1S/C6H12ClNO/c7-1-2-8-3-5-9-6-4-8/h1-6H2/i3D2,5D2 |
| InChIKey | ZAPMTSHEXFEPSD-JAJFWILCSA-N |
| XLogP | 0.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.65 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|