C7H12O2 — CID 162735404
6-methylbicyclo[3.1.0]hexane-2,3-diol (PubChem CID 162735404) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 6-methylbicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | 6-methylbicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 162735404 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 6-methylbicyclo[3.1.0]hexane-2,3-diol |
| SMILES | CC1C2CC(O)C(O)C12 |
| InChI | InChI=1S/C7H12O2/c1-3-4-2-5(8)7(9)6(3)4/h3-9H,2H2,1H3 |
| InChIKey | GDQZXINWDYJFFO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |