C22H33NO — CID 162754607
6-ethyl-3-methyl-1-phenyl-6-propylbicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 162754607) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is 6-ethyl-3-methyl-1-phenyl-6-propylbicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 6-ethyl-3-methyl-1-phenyl-6-propylbicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 162754607 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | 6-ethyl-3-methyl-1-phenyl-6-propylbicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CCCC1(CC)CCC2(c3ccccc3)CC1CC(C)(C(N)=O)C2 |
| InChI | InChI=1S/C22H33NO/c1-4-11-21(5-2)12-13-22(17-9-7-6-8-10-17)15-18(21)14-20(3,16-22)19(23)24/h6-10,18H,4-5,11-16H2,1-3H3,(H2,23,24) |
| InChIKey | DMTFEQXJPCXBGT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |