C14H19F2N5O2 — CID 162761842
N-[5-amino-6-(difluoromethoxy)-2-(4-methylpiperazin-1-yl)-3-pyridinyl]prop-2-enamide (PubChem CID 162761842) has the molecular formula C14H19F2N5O2 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-[5-amino-6-(difluoromethoxy)-2-(4-methylpiperazin-1-yl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[5-amino-6-(difluoromethoxy)-2-(4-methylpiperazin-1-yl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 162761842 |
| Molecular Formula | C14H19F2N5O2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[5-amino-6-(difluoromethoxy)-2-(4-methylpiperazin-1-yl)-3-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N)c(OC(F)F)nc1N1CCN(C)CC1 |
| InChI | InChI=1S/C14H19F2N5O2/c1-3-11(22)18-10-8-9(17)13(23-14(15)16)19-12(10)21-6-4-20(2)5-7-21/h3,8,14H,1,4-7,17H2,2H3,(H,18,22) |
| InChIKey | WWNGIOSJSMBCHZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|