C20H30N3O4S+ — CID 162767504
2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-methylamino]acetyl]oxyethyl-trimethylazanium (PubChem CID 162767504) has the molecular formula C20H30N3O4S+ and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-methylamino]acetyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-methylamino]acetyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 162767504 |
| Molecular Formula | C20H30N3O4S+ |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-methylamino]acetyl]oxyethyl-trimethylazanium |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N(C)CC(=O)OCC[N+](C)(C)C)cccc12 |
| InChI | InChI=1S/C20H30N3O4S/c1-21(2)18-11-7-10-17-16(18)9-8-12-19(17)28(25,26)22(3)15-20(24)27-14-13-23(4,5)6/h7-12H,13-15H2,1-6H3/q+1 |
| InChIKey | VCFMQVFYJWUNRE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|