C80H66N8O8 — CID 162788111
[4-[10,15,20-tris[4-(4-pyridin-4-ylbutanoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 4-pyridin-4-ylbutanoate (PubChem CID 162788111) has the molecular formula C80H66N8O8 and a molecular weight of 1267.46 g/mol. Its IUPAC name is [4-[10,15,20-tris[4-(4-pyridin-4-ylbutanoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 4-pyridin-4-ylbutanoate.
| Compound Name | [4-[10,15,20-tris[4-(4-pyridin-4-ylbutanoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 4-pyridin-4-ylbutanoate |
|---|---|
| PubChem CID | 162788111 |
| Molecular Formula | C80H66N8O8 |
| Molecular Weight | 1267.46 g/mol |
| Exact Mass | 1266.50 |
| IUPAC Name | [4-[10,15,20-tris[4-(4-pyridin-4-ylbutanoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 4-pyridin-4-ylbutanoate |
| SMILES | O=C(CCCc1ccncc1)Oc1ccc(-c2c3nc(c(-c4ccc(OC(=O)CCCc5ccncc5)cc4)c4ccc([nH]4)c(-c4ccc(OC(=O)CCCc5ccncc5)cc4)c4nc(c(-c5ccc(OC(=O)CCCc6ccncc6)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C80H66N8O8/c89-73(9-1-5-53-37-45-81-46-38-53)93-61-21-13-57(14-22-61)77-65-29-31-67(85-65)78(58-15-23-62(24-16-58)94-74(90)10-2-6-54-39-47-82-48-40-54)69-33-35-71(87-69)80(60-19-27-64(28-20-60)96-76(92)12-4-8-56-43-51-84-52-44-56)72-36-34-70(88-72)79(68-32-30-66(77)86-68)59-17-25-63(26-18-59)95-75(91)11-3-7-55-41-49-83-50-42-55/h13-52,85,88H,1-12H2/b77-65-,77-66-,78-67-,78-69-,79-68-,79-70-,80-71-,80-72- |
| InChIKey | LRMFYMFXDNJROJ-ZEQKYEIZSA-N |
| XLogP | 16.62 |
| TPSA | 214.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1267.46 |
| LogP ≤ 5 | 16.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|