C30H44O — CID 162820699
(6aR,6bS,8aR,9R,12S,12aR,14aR,14bR)-4,4,6a,6b,9,12,14b-heptamethyl-11-methylidene-1,2,6,7,8,8a,9,10,12,12a,14,14a-dodecahydropicen-3-one (PubChem CID 162820699) has the molecular formula C30H44O and a molecular weight of 420.68 g/mol. Its IUPAC name is (6aR,6bS,8aR,9R,12S,12aR,14aR,14bR)-4,4,6a,6b,9,12,14b-heptamethyl-11-methylidene-1,2,6,7,8,8a,9,10,12,12a,14,14a-dodecahydropicen-3-one.
| Compound Name | (6aR,6bS,8aR,9R,12S,12aR,14aR,14bR)-4,4,6a,6b,9,12,14b-heptamethyl-11-methylidene-1,2,6,7,8,8a,9,10,12,12a,14,14a-dodecahydropicen-3-one |
|---|---|
| PubChem CID | 162820699 |
| Molecular Formula | C30H44O |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | (6aR,6bS,8aR,9R,12S,12aR,14aR,14bR)-4,4,6a,6b,9,12,14b-heptamethyl-11-methylidene-1,2,6,7,8,8a,9,10,12,12a,14,14a-dodecahydropicen-3-one |
| SMILES | C=C1C[C@@H](C)[C@H]2CC[C@]3(C)C(=CC[C@H]4[C@@]5(C)CCC(=O)C(C)(C)C5=CC[C@]43C)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C30H44O/c1-18-17-19(2)21-11-15-29(7)22(26(21)20(18)3)9-10-24-28(6)14-13-25(31)27(4,5)23(28)12-16-30(24,29)8/h9,12,19-21,24,26H,1,10-11,13-17H2,2-8H3/t19-,20-,21-,24+,26+,28+,29-,30-/m1/s1 |
| InChIKey | SYNMJXGOQICKSJ-AAFNAFDESA-N |
| XLogP | 7.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|