C26H33NO5 — CID 162831949
[1-[5-ethyl-2-(1H-pyrrol-3-yl)cyclohex-3-en-1-yl]-5-(4-hydroxy-3-methoxyphenyl)-3-oxopentyl] acetate (PubChem CID 162831949) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is [1-[5-ethyl-2-(1H-pyrrol-3-yl)cyclohex-3-en-1-yl]-5-(4-hydroxy-3-methoxyphenyl)-3-oxopentyl] acetate.
| Compound Name | [1-[5-ethyl-2-(1H-pyrrol-3-yl)cyclohex-3-en-1-yl]-5-(4-hydroxy-3-methoxyphenyl)-3-oxopentyl] acetate |
|---|---|
| PubChem CID | 162831949 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | [1-[5-ethyl-2-(1H-pyrrol-3-yl)cyclohex-3-en-1-yl]-5-(4-hydroxy-3-methoxyphenyl)-3-oxopentyl] acetate |
| SMILES | CCC1C=CC(c2cc[nH]c2)C(C(CC(=O)CCc2ccc(O)c(OC)c2)OC(C)=O)C1 |
| InChI | InChI=1S/C26H33NO5/c1-4-18-6-9-22(20-11-12-27-16-20)23(13-18)25(32-17(2)28)15-21(29)8-5-19-7-10-24(30)26(14-19)31-3/h6-7,9-12,14,16,18,22-23,25,27,30H,4-5,8,13,15H2,1-3H3 |
| InChIKey | LGXLXUYPOPORDV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|