C24H33NO5 — CID 163127030
[1-(4-hydroxy-3-methoxyphenyl)-3-oxo-6-(2H-pyrrol-4-ylmethyl)decan-5-yl] acetate (PubChem CID 163127030) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is [1-(4-hydroxy-3-methoxyphenyl)-3-oxo-6-(2H-pyrrol-4-ylmethyl)decan-5-yl] acetate.
| Compound Name | [1-(4-hydroxy-3-methoxyphenyl)-3-oxo-6-(2H-pyrrol-4-ylmethyl)decan-5-yl] acetate |
|---|---|
| PubChem CID | 163127030 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | [1-(4-hydroxy-3-methoxyphenyl)-3-oxo-6-(2H-pyrrol-4-ylmethyl)decan-5-yl] acetate |
| SMILES | CCCCC(CC1=CCN=C1)C(CC(=O)CCc1ccc(O)c(OC)c1)OC(C)=O |
| InChI | InChI=1S/C24H33NO5/c1-4-5-6-20(13-19-11-12-25-16-19)23(30-17(2)26)15-21(27)9-7-18-8-10-22(28)24(14-18)29-3/h8,10-11,14,16,20,23,28H,4-7,9,12-13,15H2,1-3H3 |
| InChIKey | DRXKBLFMRWTLGS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |