C19H23N5O4S — CID 162850097
N-[(3R,8R,9aS)-3-benzyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-1-methylimidazole-4-sulfonamide (PubChem CID 162850097) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[(3R,8R,9aS)-3-benzyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[(3R,8R,9aS)-3-benzyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 162850097 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[(3R,8R,9aS)-3-benzyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)N[C@@H]2CCN3C(=O)[C@@H](Cc4ccccc4)NC(=O)[C@@H]3C2)c1 |
| InChI | InChI=1S/C19H23N5O4S/c1-23-11-17(20-12-23)29(27,28)22-14-7-8-24-16(10-14)18(25)21-15(19(24)26)9-13-5-3-2-4-6-13/h2-6,11-12,14-16,22H,7-10H2,1H3,(H,21,25)/t14-,15-,16+/m1/s1 |
| InChIKey | KMZWTUSTMJXWLG-OAGGEKHMSA-N |
| XLogP | -0.20 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |