C29H28O9 — CID 162862635
[5,10-diacetyloxy-2,2-dimethyl-12-(2-methylbut-3-en-2-yl)-6-oxopyrano[3,2-b]xanthen-9-yl] acetate (PubChem CID 162862635) has the molecular formula C29H28O9 and a molecular weight of 520.53 g/mol. Its IUPAC name is [5,10-diacetyloxy-2,2-dimethyl-12-(2-methylbut-3-en-2-yl)-6-oxopyrano[3,2-b]xanthen-9-yl] acetate.
| Compound Name | [5,10-diacetyloxy-2,2-dimethyl-12-(2-methylbut-3-en-2-yl)-6-oxopyrano[3,2-b]xanthen-9-yl] acetate |
|---|---|
| PubChem CID | 162862635 |
| Molecular Formula | C29H28O9 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [5,10-diacetyloxy-2,2-dimethyl-12-(2-methylbut-3-en-2-yl)-6-oxopyrano[3,2-b]xanthen-9-yl] acetate |
| SMILES | C=CC(C)(C)c1c2c(c(OC(C)=O)c3c(=O)c4ccc(OC(C)=O)c(OC(C)=O)c4oc13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C29H28O9/c1-9-28(5,6)21-24-18(12-13-29(7,8)38-24)23(35-15(3)31)20-22(33)17-10-11-19(34-14(2)30)26(36-16(4)32)25(17)37-27(20)21/h9-13H,1H2,2-8H3 |
| InChIKey | WSAIXNPWPKMIJY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|