C23H22O6 — CID 162933276
6,10,11-trihydroxy-3,3-dimethyl-5-(2-methylbut-3-en-2-yl)pyrano[2,3-c]xanthen-7-one (PubChem CID 162933276) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is 6,10,11-trihydroxy-3,3-dimethyl-5-(2-methylbut-3-en-2-yl)pyrano[2,3-c]xanthen-7-one.
| Compound Name | 6,10,11-trihydroxy-3,3-dimethyl-5-(2-methylbut-3-en-2-yl)pyrano[2,3-c]xanthen-7-one |
|---|---|
| PubChem CID | 162933276 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 6,10,11-trihydroxy-3,3-dimethyl-5-(2-methylbut-3-en-2-yl)pyrano[2,3-c]xanthen-7-one |
| SMILES | C=CC(C)(C)c1c2c(c3oc4c(O)c(O)ccc4c(=O)c3c1O)C=CC(C)(C)O2 |
| InChI | InChI=1S/C23H22O6/c1-6-22(2,3)15-18(27)14-16(25)11-7-8-13(24)17(26)21(11)28-19(14)12-9-10-23(4,5)29-20(12)15/h6-10,24,26-27H,1H2,2-5H3 |
| InChIKey | BAQLZXBGJKTVNJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|