C30H24O10 — CID 162863194
(12S,13S)-12,13-diacetyl-9,18-dihydroxy-5,6,19,20-tetramethoxyhexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1,3,5,8,10,14,17(22),18,20-nonaene-7,16-dione (PubChem CID 162863194) has the molecular formula C30H24O10 and a molecular weight of 544.51 g/mol. Its IUPAC name is (12S,13S)-12,13-diacetyl-9,18-dihydroxy-5,6,19,20-tetramethoxyhexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1,3,5,8,10,14,17(22),18,20-nonaene-7,16-dione.
| Compound Name | (12S,13S)-12,13-diacetyl-9,18-dihydroxy-5,6,19,20-tetramethoxyhexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1,3,5,8,10,14,17(22),18,20-nonaene-7,16-dione |
|---|---|
| PubChem CID | 162863194 |
| Molecular Formula | C30H24O10 |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | (12S,13S)-12,13-diacetyl-9,18-dihydroxy-5,6,19,20-tetramethoxyhexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1,3,5,8,10,14,17(22),18,20-nonaene-7,16-dione |
| SMILES | COc1c(O)c2c(=O)cc3c4c5c(cc(O)c6c(=O)c(OC)c(OC)c(c(c1OC)c24)c65)[C@@H](C(C)=O)[C@@H]3C(C)=O |
| InChI | InChI=1S/C30H24O10/c1-9(31)15-11-7-13(33)19-21-17(11)18-12(16(15)10(2)32)8-14(34)20-22(18)24(28(38-4)30(40-6)26(20)36)23(21)27(37-3)29(39-5)25(19)35/h7-8,15-16,33,36H,1-6H3/t15-,16-/m1/s1 |
| InChIKey | ZMQLNLMRJPJZDV-HZPDHXFCSA-N |
| XLogP | 3.70 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|