C23H36O4 — CID 162878133
3-oxo-3-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy)propanoic acid (PubChem CID 162878133) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is 3-oxo-3-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy)propanoic acid.
| Compound Name | 3-oxo-3-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy)propanoic acid |
|---|---|
| PubChem CID | 162878133 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 3-oxo-3-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy)propanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOC(=O)CC(=O)O |
| InChI | InChI=1S/C23H36O4/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)15-16-27-23(26)17-22(24)25/h9,11,13,15H,6-8,10,12,14,16-17H2,1-5H3,(H,24,25) |
| InChIKey | IRJLVLJFWOLRKU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|