C29H20O10 — CID 162883010
(1R,4R,15R,26R,27S)-6,13,18,20,27-pentahydroxy-9,22-dimethylheptacyclo[13.10.2.01,17.04,26.05,14.07,12.019,24]heptacosa-5(14),6,9,12,17,19(24),20,22-octaene-3,8,11,16,25-pentone (PubChem CID 162883010) has the molecular formula C29H20O10 and a molecular weight of 528.47 g/mol. Its IUPAC name is (1R,4R,15R,26R,27S)-6,13,18,20,27-pentahydroxy-9,22-dimethylheptacyclo[13.10.2.01,17.04,26.05,14.07,12.019,24]heptacosa-5(14),6,9,12,17,19(24),20,22-octaene-3,8,11,16,25-pentone.
| Compound Name | (1R,4R,15R,26R,27S)-6,13,18,20,27-pentahydroxy-9,22-dimethylheptacyclo[13.10.2.01,17.04,26.05,14.07,12.019,24]heptacosa-5(14),6,9,12,17,19(24),20,22-octaene-3,8,11,16,25-pentone |
|---|---|
| PubChem CID | 162883010 |
| Molecular Formula | C29H20O10 |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | (1R,4R,15R,26R,27S)-6,13,18,20,27-pentahydroxy-9,22-dimethylheptacyclo[13.10.2.01,17.04,26.05,14.07,12.019,24]heptacosa-5(14),6,9,12,17,19(24),20,22-octaene-3,8,11,16,25-pentone |
| SMILES | CC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)[C@@H]1C(=O)C[C@]24C(=O)c5cc(C)cc(O)c5C(O)=C2C(=O)[C@H]3[C@@H](O)[C@H]14 |
| InChI | InChI=1S/C29H20O10/c1-7-3-9-13(10(30)4-7)25(36)21-27(38)19-17-16(14-12(32)6-29(21,28(9)39)20(14)26(19)37)24(35)18-15(23(17)34)11(31)5-8(2)22(18)33/h3-5,14,19-20,26,30,34-37H,6H2,1-2H3/t14-,19+,20-,26+,29+/m0/s1 |
| InChIKey | MCANIDYRTKAODJ-SFZXIUDESA-N |
| XLogP | 2.30 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|