C30H22O10 — CID 6326683
(1R,14S,15S)-8,10,14,18,25-pentahydroxy-6,21-dimethylheptacyclo[14.11.1.02,11.02,15.04,9.017,26.019,24]octacosa-4(9),5,7,10,17(26),18,21,24-octaene-3,12,20,23,27-pentone (PubChem CID 6326683) has the molecular formula C30H22O10 and a molecular weight of 542.50 g/mol. Its IUPAC name is (1R,14S,15S)-8,10,14,18,25-pentahydroxy-6,21-dimethylheptacyclo[14.11.1.02,11.02,15.04,9.017,26.019,24]octacosa-4(9),5,7,10,17(26),18,21,24-octaene-3,12,20,23,27-pentone.
| Compound Name | (1R,14S,15S)-8,10,14,18,25-pentahydroxy-6,21-dimethylheptacyclo[14.11.1.02,11.02,15.04,9.017,26.019,24]octacosa-4(9),5,7,10,17(26),18,21,24-octaene-3,12,20,23,27-pentone |
|---|---|
| PubChem CID | 6326683 |
| Molecular Formula | C30H22O10 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | (1R,14S,15S)-8,10,14,18,25-pentahydroxy-6,21-dimethylheptacyclo[14.11.1.02,11.02,15.04,9.017,26.019,24]octacosa-4(9),5,7,10,17(26),18,21,24-octaene-3,12,20,23,27-pentone |
| SMILES | CC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)C1C[C@@H](C3=O)C23C(=O)c4cc(C)cc(O)c4C(O)=C2C(=O)C[C@H](O)[C@@H]13 |
| InChI | InChI=1S/C30H22O10/c1-8-3-11-17(13(31)4-8)28(39)23-16(34)7-15(33)22-10-6-12(30(22,23)29(11)40)25(36)20-18(10)26(37)21-19(27(20)38)14(32)5-9(2)24(21)35/h3-5,10,12,15,22,31,33,37-39H,6-7H2,1-2H3/t10?,12-,15-,22+,30?/m0/s1 |
| InChIKey | WOIVPPYLIZNFSY-YRKFRMOSSA-N |
| XLogP | 2.84 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|