C20H32O6 — CID 162893180
2-[(2R,4aS,5R,6S,8aS)-5-(carboxymethyl)-2,5,8a-trimethyl-2-[(2R)-oxiran-2-yl]-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid (PubChem CID 162893180) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-[(2R,4aS,5R,6S,8aS)-5-(carboxymethyl)-2,5,8a-trimethyl-2-[(2R)-oxiran-2-yl]-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid.
| Compound Name | 2-[(2R,4aS,5R,6S,8aS)-5-(carboxymethyl)-2,5,8a-trimethyl-2-[(2R)-oxiran-2-yl]-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 162893180 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-[(2R,4aS,5R,6S,8aS)-5-(carboxymethyl)-2,5,8a-trimethyl-2-[(2R)-oxiran-2-yl]-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)[C@H]1CC[C@]2(C)O[C@@](C)([C@H]3CO3)CC[C@H]2[C@]1(C)CC(=O)O |
| InChI | InChI=1S/C20H32O6/c1-17(2,16(23)24)12-6-8-19(4)13(18(12,3)10-15(21)22)7-9-20(5,26-19)14-11-25-14/h12-14H,6-11H2,1-5H3,(H,21,22)(H,23,24)/t12-,13+,14-,18-,19+,20-/m1/s1 |
| InChIKey | OQHHMEQHMAJSTD-CMKQGYTDSA-N |
| XLogP | 3.33 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|