C20H26O7 — CID 162895425
but-2-en-2-yl (8-hydroxy-9,14-dimethyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[7.5.0.02,6.012,14]tetradecan-10-yl) carbonate (PubChem CID 162895425) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is but-2-en-2-yl (8-hydroxy-9,14-dimethyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[7.5.0.02,6.012,14]tetradecan-10-yl) carbonate.
| Compound Name | but-2-en-2-yl (8-hydroxy-9,14-dimethyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[7.5.0.02,6.012,14]tetradecan-10-yl) carbonate |
|---|---|
| PubChem CID | 162895425 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | but-2-en-2-yl (8-hydroxy-9,14-dimethyl-5-methylidene-4-oxo-3,13-dioxatetracyclo[7.5.0.02,6.012,14]tetradecan-10-yl) carbonate |
| SMILES | C=C1C(=O)OC2C1CC(O)C1(C)C(OC(=O)OC(C)=CC)CC3OC3(C)C21 |
| InChI | InChI=1S/C20H26O7/c1-6-9(2)24-18(23)25-13-8-14-20(5,27-14)16-15-11(10(3)17(22)26-15)7-12(21)19(13,16)4/h6,11-16,21H,3,7-8H2,1-2,4-5H3 |
| InChIKey | JLUWJRKKMCCEBA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|