C19H28O3 — CID 162905450
(4S,6S,7S,12S)-7-hydroxy-4,16,16-trimethyl-9-methylidene-5-oxatricyclo[10.3.1.04,6]hexadec-1(15)-en-2-one (PubChem CID 162905450) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (4S,6S,7S,12S)-7-hydroxy-4,16,16-trimethyl-9-methylidene-5-oxatricyclo[10.3.1.04,6]hexadec-1(15)-en-2-one.
| Compound Name | (4S,6S,7S,12S)-7-hydroxy-4,16,16-trimethyl-9-methylidene-5-oxatricyclo[10.3.1.04,6]hexadec-1(15)-en-2-one |
|---|---|
| PubChem CID | 162905450 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (4S,6S,7S,12S)-7-hydroxy-4,16,16-trimethyl-9-methylidene-5-oxatricyclo[10.3.1.04,6]hexadec-1(15)-en-2-one |
| SMILES | C=C1CC[C@@H]2CCC=C(C(=O)C[C@]3(C)O[C@H]3[C@@H](O)C1)C2(C)C |
| InChI | InChI=1S/C19H28O3/c1-12-8-9-13-6-5-7-14(18(13,2)3)16(21)11-19(4)17(22-19)15(20)10-12/h7,13,15,17,20H,1,5-6,8-11H2,2-4H3/t13-,15-,17-,19-/m0/s1 |
| InChIKey | HOLAXAWUGWLWRE-CJCBUOBESA-N |
| XLogP | 3.57 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|