C19H28O2 — CID 23244088
(4E,6S,11S)-6-hydroxy-4,15,15-trimethyl-8-methylidenebicyclo[9.3.1]pentadeca-1(14),4-dien-2-one (PubChem CID 23244088) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (4E,6S,11S)-6-hydroxy-4,15,15-trimethyl-8-methylidenebicyclo[9.3.1]pentadeca-1(14),4-dien-2-one.
| Compound Name | (4E,6S,11S)-6-hydroxy-4,15,15-trimethyl-8-methylidenebicyclo[9.3.1]pentadeca-1(14),4-dien-2-one |
|---|---|
| PubChem CID | 23244088 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (4E,6S,11S)-6-hydroxy-4,15,15-trimethyl-8-methylidenebicyclo[9.3.1]pentadeca-1(14),4-dien-2-one |
| SMILES | C=C1CC[C@@H]2CCC=C(C(=O)C/C(C)=C/[C@@H](O)C1)C2(C)C |
| InChI | InChI=1S/C19H28O2/c1-13-8-9-15-6-5-7-17(19(15,3)4)18(21)12-14(2)11-16(20)10-13/h7,11,15-16,20H,1,5-6,8-10,12H2,2-4H3/b14-11+/t15-,16-/m0/s1 |
| InChIKey | JWAJDLYSFBHBSW-SROTWBRCSA-N |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|